[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid

C6H14N3O5P — CID 23728613

IUPAC[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid
SMILESNC(=O)CCC(NCP(=O)(O)O)C(N)=O
InChIInChI=1S/C6H14N3O5P/c7-5(10)2-1-4(6(8)11)9-3-15(12,13)14/h4,9H,1-3H2,(H2,7,10)(H2,8,11)(H2,12,13,14)
InChIKeyXHSKIHLPSXWYIR-UHFFFAOYSA-N
MW239.17 g/mol
LogP-2.17
Rot. Bonds7

About [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid

[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid (PubChem CID 23728613) has the molecular formula C6H14N3O5P and a molecular weight of 239.17 g/mol. Its IUPAC name is [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid.

Molecular Properties

Compound Name[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid
PubChem CID23728613
Molecular FormulaC6H14N3O5P
Molecular Weight239.17 g/mol
Exact Mass239.07
IUPAC Name[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid
SMILESNC(=O)CCC(NCP(=O)(O)O)C(N)=O
InChIInChI=1S/C6H14N3O5P/c7-5(10)2-1-4(6(8)11)9-3-15(12,13)14/h4,9H,1-3H2,(H2,7,10)(H2,8,11)(H2,12,13,14)
InChIKeyXHSKIHLPSXWYIR-UHFFFAOYSA-N
XLogP-2.17
TPSA155.74 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.17
LogP ≤ 5-2.17
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid?
The IUPAC name of [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid (CID 23728613) is [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid.
What is the SMILES notation for [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid?
The canonical SMILES for [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid is NC(=O)CCC(NCP(=O)(O)O)C(N)=O.
What is the InChIKey of [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid?
The InChIKey is XHSKIHLPSXWYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N3O5P/c7-5(10)2-1-4(6(8)11)9-3-15(12,13)14/h4,9H,1-3H2,(H2,7,10)(H2,8,11)(H2,12,13,14).
What are the key properties of [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid?
[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid has a molecular weight of 239.17 g/mol, XLogP of -2.17, 7 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid is sourced from PubChem (CID 23728613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).