C6H14N3O5P — CID 23728613
[(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid (PubChem CID 23728613) has the molecular formula C6H14N3O5P and a molecular weight of 239.17 g/mol. Its IUPAC name is [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid.
| Compound Name | [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 23728613 |
| Molecular Formula | C6H14N3O5P |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | [(1,5-diamino-1,5-dioxopentan-2-yl)amino]methylphosphonic acid |
| SMILES | NC(=O)CCC(NCP(=O)(O)O)C(N)=O |
| InChI | InChI=1S/C6H14N3O5P/c7-5(10)2-1-4(6(8)11)9-3-15(12,13)14/h4,9H,1-3H2,(H2,7,10)(H2,8,11)(H2,12,13,14) |
| InChIKey | XHSKIHLPSXWYIR-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|