C7H13N3O3S — CID 172744013
2-[(2-sulfanylacetyl)amino]pentanediamide (PubChem CID 172744013) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-[(2-sulfanylacetyl)amino]pentanediamide.
| Compound Name | 2-[(2-sulfanylacetyl)amino]pentanediamide |
|---|---|
| PubChem CID | 172744013 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-[(2-sulfanylacetyl)amino]pentanediamide |
| SMILES | NC(=O)CCC(NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C7H13N3O3S/c8-5(11)2-1-4(7(9)13)10-6(12)3-14/h4,14H,1-3H2,(H2,8,11)(H2,9,13)(H,10,12) |
| InChIKey | JMAGKCOJSNIXOV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|