C7H13N3O3S2 — CID 174474418
3-sulfanyl-2-[(2-sulfanylacetyl)amino]pentanediamide (PubChem CID 174474418) has the molecular formula C7H13N3O3S2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-sulfanyl-2-[(2-sulfanylacetyl)amino]pentanediamide.
| Compound Name | 3-sulfanyl-2-[(2-sulfanylacetyl)amino]pentanediamide |
|---|---|
| PubChem CID | 174474418 |
| Molecular Formula | C7H13N3O3S2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 3-sulfanyl-2-[(2-sulfanylacetyl)amino]pentanediamide |
| SMILES | NC(=O)CC(S)C(NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C7H13N3O3S2/c8-4(11)1-3(15)6(7(9)13)10-5(12)2-14/h3,6,14-15H,1-2H2,(H2,8,11)(H2,9,13)(H,10,12) |
| InChIKey | NQZYPWMACZGXMW-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|