C8H17N3O2S — CID 139245344
2-acetamido-6-amino-3-sulfanylhexanamide (PubChem CID 139245344) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-acetamido-6-amino-3-sulfanylhexanamide.
| Compound Name | 2-acetamido-6-amino-3-sulfanylhexanamide |
|---|---|
| PubChem CID | 139245344 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-acetamido-6-amino-3-sulfanylhexanamide |
| SMILES | CC(=O)NC(C(N)=O)C(S)CCCN |
| InChI | InChI=1S/C8H17N3O2S/c1-5(12)11-7(8(10)13)6(14)3-2-4-9/h6-7,14H,2-4,9H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | JQFSJVVJUQZMBQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|