(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid

C12H26N4O5 — CID 159030403

IUPAC(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid
SMILESCC(=O)N[C@@H](CCCN)C(=O)O.NCCC[C@H](N)C(=O)O
InChIInChI=1S/C7H14N2O3.C5H12N2O2/c1-5(10)9-6(7(11)12)3-2-4-8;6-3-1-2-4(7)5(8)9/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-3,6-7H2,(H,8,9)/t6-;4-/m00/s1
InChIKeyJUUUMFUBTHXSEN-FPAZSGHZSA-N
MW306.36 g/mol
LogP-1.55
Rot. Bonds9

About (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid

(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid (PubChem CID 159030403) has the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid.

Molecular Properties

Compound Name(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid
PubChem CID159030403
Molecular FormulaC12H26N4O5
Molecular Weight306.36 g/mol
Exact Mass306.19
IUPAC Name(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid
SMILESCC(=O)N[C@@H](CCCN)C(=O)O.NCCC[C@H](N)C(=O)O
InChIInChI=1S/C7H14N2O3.C5H12N2O2/c1-5(10)9-6(7(11)12)3-2-4-8;6-3-1-2-4(7)5(8)9/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-3,6-7H2,(H,8,9)/t6-;4-/m00/s1
InChIKeyJUUUMFUBTHXSEN-FPAZSGHZSA-N
XLogP-1.55
TPSA181.76 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.36
LogP ≤ 5-1.55
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid?
The IUPAC name of (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid (CID 159030403) is (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid.
What is the SMILES notation for (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid?
The canonical SMILES for (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid is CC(=O)N[C@@H](CCCN)C(=O)O.NCCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid?
The InChIKey is JUUUMFUBTHXSEN-FPAZSGHZSA-N. The full InChI is InChI=1S/C7H14N2O3.C5H12N2O2/c1-5(10)9-6(7(11)12)3-2-4-8;6-3-1-2-4(7)5(8)9/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-3,6-7H2,(H,8,9)/t6-;4-/m00/s1.
What are the key properties of (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid?
(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid has a molecular weight of 306.36 g/mol, XLogP of -1.55, 9 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid is sourced from PubChem (CID 159030403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).