C12H26N4O5 — CID 159030403
(2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid (PubChem CID 159030403) has the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid.
| Compound Name | (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid |
|---|---|
| PubChem CID | 159030403 |
| Molecular Formula | C12H26N4O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-2-acetamido-5-aminopentanoic acid;(2S)-2,5-diaminopentanoic acid |
| SMILES | CC(=O)N[C@@H](CCCN)C(=O)O.NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3.C5H12N2O2/c1-5(10)9-6(7(11)12)3-2-4-8;6-3-1-2-4(7)5(8)9/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12);4H,1-3,6-7H2,(H,8,9)/t6-;4-/m00/s1 |
| InChIKey | JUUUMFUBTHXSEN-FPAZSGHZSA-N |
| XLogP | -1.55 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |