C10H21N3O5 — CID 174935142
2-acetamido-6-aminohexanoic acid;2-aminoacetic acid (PubChem CID 174935142) has the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-acetamido-6-aminohexanoic acid;2-aminoacetic acid.
| Compound Name | 2-acetamido-6-aminohexanoic acid;2-aminoacetic acid |
|---|---|
| PubChem CID | 174935142 |
| Molecular Formula | C10H21N3O5 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-acetamido-6-aminohexanoic acid;2-aminoacetic acid |
| SMILES | CC(=O)NC(CCCCN)C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C8H16N2O3.C2H5NO2/c1-6(11)10-7(8(12)13)4-2-3-5-9;3-1-2(4)5/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13);1,3H2,(H,4,5) |
| InChIKey | STWGYALNEBWQQL-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|