C7H17N3O — CID 137385208
N-[(2R)-2,5-diaminopentyl]acetamide (PubChem CID 137385208) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is N-[(2R)-2,5-diaminopentyl]acetamide.
| Compound Name | N-[(2R)-2,5-diaminopentyl]acetamide |
|---|---|
| PubChem CID | 137385208 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | N-[(2R)-2,5-diaminopentyl]acetamide |
| SMILES | CC(=O)NC[C@H](N)CCCN |
| InChI | InChI=1S/C7H17N3O/c1-6(11)10-5-7(9)3-2-4-8/h7H,2-5,8-9H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | LBESCZBLSNDRMB-SSDOTTSWSA-N |
| XLogP | -0.81 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |