C10H23N3O — CID 156664171
N-[(2R)-2,5-diaminopentyl]-3-methylbutanamide (PubChem CID 156664171) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[(2R)-2,5-diaminopentyl]-3-methylbutanamide.
| Compound Name | N-[(2R)-2,5-diaminopentyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 156664171 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | N-[(2R)-2,5-diaminopentyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC[C@H](N)CCCN |
| InChI | InChI=1S/C10H23N3O/c1-8(2)6-10(14)13-7-9(12)4-3-5-11/h8-9H,3-7,11-12H2,1-2H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | ZPHQZKDOJWYLTF-SECBINFHSA-N |
| XLogP | 0.21 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |