About 3-sulfanylpentanediamide
3-sulfanylpentanediamide (PubChem CID 87903266) has the molecular formula C5H10N2O2S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 3-sulfanylpentanediamide.
Molecular Properties
| Compound Name | 3-sulfanylpentanediamide |
| PubChem CID | 87903266 |
| Molecular Formula | C5H10N2O2S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3-sulfanylpentanediamide |
| SMILES | NC(=O)CC(S)CC(N)=O |
| InChI | InChI=1S/C5H10N2O2S/c6-4(8)1-3(10)2-5(7)9/h3,10H,1-2H2,(H2,6,8)(H2,7,9) |
| InChIKey | MCCROPAFGJATJU-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpentanediamide?
The IUPAC name of 3-sulfanylpentanediamide (CID 87903266) is 3-sulfanylpentanediamide.
What is the SMILES notation for 3-sulfanylpentanediamide?
The canonical SMILES for 3-sulfanylpentanediamide is NC(=O)CC(S)CC(N)=O.
What is the InChIKey of 3-sulfanylpentanediamide?
The InChIKey is MCCROPAFGJATJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2S/c6-4(8)1-3(10)2-5(7)9/h3,10H,1-2H2,(H2,6,8)(H2,7,9).
What are the key properties of 3-sulfanylpentanediamide?
3-sulfanylpentanediamide has a molecular weight of 162.21 g/mol, XLogP of -0.96, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpentanediamide is sourced from PubChem (CID 87903266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).