C5H10N2O2S — CID 90274310
(2S)-4-amino-2-(methylamino)-4-oxobutanethioic S-acid (PubChem CID 90274310) has the molecular formula C5H10N2O2S and a molecular weight of 162.21 g/mol. Its IUPAC name is (2S)-4-amino-2-(methylamino)-4-oxobutanethioic S-acid.
| Compound Name | (2S)-4-amino-2-(methylamino)-4-oxobutanethioic S-acid |
|---|---|
| PubChem CID | 90274310 |
| Molecular Formula | C5H10N2O2S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (2S)-4-amino-2-(methylamino)-4-oxobutanethioic S-acid |
| SMILES | CN[C@@H](CC(N)=O)C(=O)S |
| InChI | InChI=1S/C5H10N2O2S/c1-7-3(5(9)10)2-4(6)8/h3,7H,2H2,1H3,(H2,6,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | JGLWWCRKPYZFPW-VKHMYHEASA-N |
| XLogP | -1.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|