C7H15N3O2S — CID 165386764
3-(2-amino-2-oxoethyl)sulfanyl-N-methyl-2-(methylamino)propanamide (PubChem CID 165386764) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-methyl-2-(methylamino)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 165386764 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-methyl-2-(methylamino)propanamide |
| SMILES | CNC(=O)C(CSCC(N)=O)NC |
| InChI | InChI=1S/C7H15N3O2S/c1-9-5(7(12)10-2)3-13-4-6(8)11/h5,9H,3-4H2,1-2H3,(H2,8,11)(H,10,12) |
| InChIKey | WMGLWAFEXWVPAK-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |