C12H23N5O4 — CID 142463784
N-methyl-2-[2-[2-(methylamino)propanoylamino]propanoylamino]butanediamide (PubChem CID 142463784) has the molecular formula C12H23N5O4 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-methyl-2-[2-[2-(methylamino)propanoylamino]propanoylamino]butanediamide.
| Compound Name | N-methyl-2-[2-[2-(methylamino)propanoylamino]propanoylamino]butanediamide |
|---|---|
| PubChem CID | 142463784 |
| Molecular Formula | C12H23N5O4 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-methyl-2-[2-[2-(methylamino)propanoylamino]propanoylamino]butanediamide |
| SMILES | CNC(=O)C(CC(N)=O)NC(=O)C(C)NC(=O)C(C)NC |
| InChI | InChI=1S/C12H23N5O4/c1-6(14-3)10(19)16-7(2)11(20)17-8(5-9(13)18)12(21)15-4/h6-8,14H,5H2,1-4H3,(H2,13,18)(H,15,21)(H,16,19)(H,17,20) |
| InChIKey | WLVUXTYVJZVXOL-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |