C14H27N5O4S — CID 91476558
2-[2-[(2-amino-3-methylbutanoyl)amino]propanoylamino]-N-(1-sulfanylethyl)butanediamide (PubChem CID 91476558) has the molecular formula C14H27N5O4S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[2-[(2-amino-3-methylbutanoyl)amino]propanoylamino]-N-(1-sulfanylethyl)butanediamide.
| Compound Name | 2-[2-[(2-amino-3-methylbutanoyl)amino]propanoylamino]-N-(1-sulfanylethyl)butanediamide |
|---|---|
| PubChem CID | 91476558 |
| Molecular Formula | C14H27N5O4S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[2-[(2-amino-3-methylbutanoyl)amino]propanoylamino]-N-(1-sulfanylethyl)butanediamide |
| SMILES | CC(S)NC(=O)C(CC(N)=O)NC(=O)C(C)NC(=O)C(N)C(C)C |
| InChI | InChI=1S/C14H27N5O4S/c1-6(2)11(16)14(23)17-7(3)12(21)19-9(5-10(15)20)13(22)18-8(4)24/h6-9,11,24H,5,16H2,1-4H3,(H2,15,20)(H,17,23)(H,18,22)(H,19,21) |
| InChIKey | PVDTVQTYSDKJCH-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|