C18H31N5O8 — CID 11247800
(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-carboxybutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 11247800) has the molecular formula C18H31N5O8 and a molecular weight of 445.47 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-carboxybutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-carboxybutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11247800 |
| Molecular Formula | C18H31N5O8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-carboxybutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H31N5O8/c1-8(2)14(20)17(29)22-10(5-7-13(25)26)16(28)21-9(3)15(27)23-11(18(30)31)4-6-12(19)24/h8-11,14H,4-7,20H2,1-3H3,(H2,19,24)(H,21,28)(H,22,29)(H,23,27)(H,25,26)(H,30,31)/t9-,10-,11-,14-/m0/s1 |
| InChIKey | SOZWAFPHHVVPQM-RMIALFOJSA-N |
| XLogP | -2.34 |
| TPSA | 231.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |