C8H17N7O3S — CID 146243540
N-(2-amino-2-oxoethyl)-3-(2-amino-2-oxoethyl)sulfanyl-2-[2-(diaminomethylidene)hydrazinyl]propanamide (PubChem CID 146243540) has the molecular formula C8H17N7O3S and a molecular weight of 291.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(2-amino-2-oxoethyl)sulfanyl-2-[2-(diaminomethylidene)hydrazinyl]propanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(2-amino-2-oxoethyl)sulfanyl-2-[2-(diaminomethylidene)hydrazinyl]propanamide |
|---|---|
| PubChem CID | 146243540 |
| Molecular Formula | C8H17N7O3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(2-amino-2-oxoethyl)sulfanyl-2-[2-(diaminomethylidene)hydrazinyl]propanamide |
| SMILES | NC(=O)CNC(=O)C(CSCC(N)=O)NN=C(N)N |
| InChI | InChI=1S/C8H17N7O3S/c9-5(16)1-13-7(18)4(14-15-8(11)12)2-19-3-6(10)17/h4,14H,1-3H2,(H2,9,16)(H2,10,17)(H,13,18)(H4,11,12,15) |
| InChIKey | JPHZNSWBGUIEIZ-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 191.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|