C16H30N2O6S — CID 59718250
2-[2-[3-[(2-amino-2-oxoethyl)amino]-2-methyl-3-oxopropyl]sulfanylethoxymethoxy]ethyl 2-methylbutanoate (PubChem CID 59718250) has the molecular formula C16H30N2O6S and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-[2-[3-[(2-amino-2-oxoethyl)amino]-2-methyl-3-oxopropyl]sulfanylethoxymethoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2-[3-[(2-amino-2-oxoethyl)amino]-2-methyl-3-oxopropyl]sulfanylethoxymethoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59718250 |
| Molecular Formula | C16H30N2O6S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[2-[3-[(2-amino-2-oxoethyl)amino]-2-methyl-3-oxopropyl]sulfanylethoxymethoxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOCOCCSCC(C)C(=O)NCC(N)=O |
| InChI | InChI=1S/C16H30N2O6S/c1-4-12(2)16(21)24-6-5-22-11-23-7-8-25-10-13(3)15(20)18-9-14(17)19/h12-13H,4-11H2,1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | COXUXNMPICZEHV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|