C18H34O9S2 — CID 59718245
3-[2,2-dimethyl-3-[2-[2-(2-methylbutanoyloxy)ethoxymethoxy]ethylsulfanyl]propanoyl]oxypropane-1-sulfonic acid (PubChem CID 59718245) has the molecular formula C18H34O9S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-[2,2-dimethyl-3-[2-[2-(2-methylbutanoyloxy)ethoxymethoxy]ethylsulfanyl]propanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[2,2-dimethyl-3-[2-[2-(2-methylbutanoyloxy)ethoxymethoxy]ethylsulfanyl]propanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59718245 |
| Molecular Formula | C18H34O9S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3-[2,2-dimethyl-3-[2-[2-(2-methylbutanoyloxy)ethoxymethoxy]ethylsulfanyl]propanoyl]oxypropane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)OCCOCOCCSCC(C)(C)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C18H34O9S2/c1-5-15(2)16(19)26-9-8-24-14-25-10-11-28-13-18(3,4)17(20)27-7-6-12-29(21,22)23/h15H,5-14H2,1-4H3,(H,21,22,23) |
| InChIKey | FSFSTAZDXLHTQX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|