C20H36O7S — CID 122416978
2-methylpropyl 3-[3-[2-hydroxy-3-(2-methylbutanoyloxy)propoxy]-3-oxopropyl]sulfanyl-2,2-dimethylpropanoate (PubChem CID 122416978) has the molecular formula C20H36O7S and a molecular weight of 420.57 g/mol. Its IUPAC name is 2-methylpropyl 3-[3-[2-hydroxy-3-(2-methylbutanoyloxy)propoxy]-3-oxopropyl]sulfanyl-2,2-dimethylpropanoate.
| Compound Name | 2-methylpropyl 3-[3-[2-hydroxy-3-(2-methylbutanoyloxy)propoxy]-3-oxopropyl]sulfanyl-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122416978 |
| Molecular Formula | C20H36O7S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-methylpropyl 3-[3-[2-hydroxy-3-(2-methylbutanoyloxy)propoxy]-3-oxopropyl]sulfanyl-2,2-dimethylpropanoate |
| SMILES | CCC(C)C(=O)OCC(O)COC(=O)CCSCC(C)(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C20H36O7S/c1-7-15(4)18(23)26-12-16(21)11-25-17(22)8-9-28-13-20(5,6)19(24)27-10-14(2)3/h14-16,21H,7-13H2,1-6H3 |
| InChIKey | LJBUBTNUIYHFTJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|