C32H60O8S — CID 91526798
ethyl 2,2-dimethylbutanoate;2-[3-[3-(2-ethylhexoxy)-2,2-dimethyl-3-oxopropyl]sulfanylpropanoyloxy]ethyl 2,2-dimethylbutanoate (PubChem CID 91526798) has the molecular formula C32H60O8S and a molecular weight of 604.89 g/mol. Its IUPAC name is ethyl 2,2-dimethylbutanoate;2-[3-[3-(2-ethylhexoxy)-2,2-dimethyl-3-oxopropyl]sulfanylpropanoyloxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | ethyl 2,2-dimethylbutanoate;2-[3-[3-(2-ethylhexoxy)-2,2-dimethyl-3-oxopropyl]sulfanylpropanoyloxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91526798 |
| Molecular Formula | C32H60O8S |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | ethyl 2,2-dimethylbutanoate;2-[3-[3-(2-ethylhexoxy)-2,2-dimethyl-3-oxopropyl]sulfanylpropanoyloxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)(C)CSCCC(=O)OCCOC(=O)C(C)(C)CC.CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C24H44O6S.C8H16O2/c1-8-11-12-19(9-2)17-30-22(27)24(6,7)18-31-16-13-20(25)28-14-15-29-21(26)23(4,5)10-3;1-5-8(3,4)7(9)10-6-2/h19H,8-18H2,1-7H3;5-6H2,1-4H3 |
| InChIKey | MDDXQJVNIWGNED-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|