C10H20O5S — CID 89331027
3-(2,3,3-trimethylbutanoyloxy)propane-1-sulfonic acid (PubChem CID 89331027) has the molecular formula C10H20O5S and a molecular weight of 252.33 g/mol. Its IUPAC name is 3-(2,3,3-trimethylbutanoyloxy)propane-1-sulfonic acid.
| Compound Name | 3-(2,3,3-trimethylbutanoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89331027 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(2,3,3-trimethylbutanoyloxy)propane-1-sulfonic acid |
| SMILES | CC(C(=O)OCCCS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H20O5S/c1-8(10(2,3)4)9(11)15-6-5-7-16(12,13)14/h8H,5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | XFBZTFZMSFHQIQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|