C5H11NaO5S2 — CID 173051395
sodium;hydride;2-(2-sulfanylpropanoyloxy)ethanesulfonic acid (PubChem CID 173051395) has the molecular formula C5H11NaO5S2 and a molecular weight of 238.26 g/mol. Its IUPAC name is sodium;hydride;2-(2-sulfanylpropanoyloxy)ethanesulfonic acid.
| Compound Name | sodium;hydride;2-(2-sulfanylpropanoyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 173051395 |
| Molecular Formula | C5H11NaO5S2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | sodium;hydride;2-(2-sulfanylpropanoyloxy)ethanesulfonic acid |
| SMILES | CC(S)C(=O)OCCS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H10O5S2.Na.H/c1-4(11)5(6)10-2-3-12(7,8)9;;/h4,11H,2-3H2,1H3,(H,7,8,9);;/q;+1;-1 |
| InChIKey | SKJWULSFVWVBIB-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|