C10H22O11P2S — CID 164800900
3-[2-ethyl-4-[hydroxy(phosphonooxy)phosphoryl]pentanoyl]oxypropane-1-sulfonic acid (PubChem CID 164800900) has the molecular formula C10H22O11P2S and a molecular weight of 412.29 g/mol. Its IUPAC name is 3-[2-ethyl-4-[hydroxy(phosphonooxy)phosphoryl]pentanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[2-ethyl-4-[hydroxy(phosphonooxy)phosphoryl]pentanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 164800900 |
| Molecular Formula | C10H22O11P2S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 3-[2-ethyl-4-[hydroxy(phosphonooxy)phosphoryl]pentanoyl]oxypropane-1-sulfonic acid |
| SMILES | CCC(CC(C)P(=O)(O)OP(=O)(O)O)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H22O11P2S/c1-3-9(10(11)20-5-4-6-24(17,18)19)7-8(2)22(12,13)21-23(14,15)16/h8-9H,3-7H2,1-2H3,(H,12,13)(H2,14,15,16)(H,17,18,19) |
| InChIKey | JDSNOHJTIHTWMD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|