C16H34NO10PS — CID 159324513
2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-phosphonooxyethyl 2-methylbutanoate (PubChem CID 159324513) has the molecular formula C16H34NO10PS and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-phosphonooxyethyl 2-methylbutanoate.
| Compound Name | 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-phosphonooxyethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 159324513 |
| Molecular Formula | C16H34NO10PS |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-phosphonooxyethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)NC(C)(C)CS(=O)(=O)O.CCC(C)C(=O)OCCOP(=O)(O)O |
| InChI | InChI=1S/C9H19NO4S.C7H15O6P/c1-5-7(2)8(11)10-9(3,4)6-15(12,13)14;1-3-6(2)7(8)12-4-5-13-14(9,10)11/h7H,5-6H2,1-4H3,(H,10,11)(H,12,13,14);6H,3-5H2,1-2H3,(H2,9,10,11) |
| InChIKey | LEENIZMRACLNQR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|