About benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate
benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate (PubChem CID 170532141) has the molecular formula C16H24N2O5S
and a molecular weight of 356.44 g/mol. Its IUPAC name is benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate.
Molecular Properties
| Compound Name | benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate |
| PubChem CID | 170532141 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate |
| SMILES | CCC(C)C(=O)NC(C)(C)CS(=O)(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O5S/c1-5-12(2)14(19)17-16(3,4)11-24(21,22)23-18-15(20)13-9-7-6-8-10-13/h6-10,12H,5,11H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | LIMYILAZHXQICO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate?
The IUPAC name of benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate (CID 170532141) is benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate.
What is the SMILES notation for benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate?
The canonical SMILES for benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate is CCC(C)C(=O)NC(C)(C)CS(=O)(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate?
The InChIKey is LIMYILAZHXQICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O5S/c1-5-12(2)14(19)17-16(3,4)11-24(21,22)23-18-15(20)13-9-7-6-8-10-13/h6-10,12H,5,11H2,1-4H3,(H,17,19)(H,18,20).
What are the key properties of benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate?
benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate has a molecular weight of 356.44 g/mol, XLogP of 1.62, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido 2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonate is sourced from PubChem (CID 170532141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).