C15H21NO4 — CID 101027737
methyl (2S,3S)-2-benzamido-3-ethoxy-2-methylbutanoate (PubChem CID 101027737) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl (2S,3S)-2-benzamido-3-ethoxy-2-methylbutanoate.
| Compound Name | methyl (2S,3S)-2-benzamido-3-ethoxy-2-methylbutanoate |
|---|---|
| PubChem CID | 101027737 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl (2S,3S)-2-benzamido-3-ethoxy-2-methylbutanoate |
| SMILES | CCO[C@@H](C)[C@](C)(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H21NO4/c1-5-20-11(2)15(3,14(18)19-4)16-13(17)12-9-7-6-8-10-12/h6-11H,5H2,1-4H3,(H,16,17)/t11-,15-/m0/s1 |
| InChIKey | VHDSSFGAEDLMHN-NHYWBVRUSA-N |
| XLogP | 1.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |