C14H18BrNO3 — CID 101241068
methyl (2R)-2-benzamido-2-bromo-3,3-dimethylbutanoate (PubChem CID 101241068) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is methyl (2R)-2-benzamido-2-bromo-3,3-dimethylbutanoate.
| Compound Name | methyl (2R)-2-benzamido-2-bromo-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 101241068 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | methyl (2R)-2-benzamido-2-bromo-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@@](Br)(NC(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H18BrNO3/c1-13(2,3)14(15,12(18)19-4)16-11(17)10-8-6-5-7-9-10/h5-9H,1-4H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | PJUQCNLOAVUTGA-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|