C19H19NO3Se — CID 11417836
methyl (E,2S)-2-benzamido-2-methyl-4-phenylselanylbut-3-enoate (PubChem CID 11417836) has the molecular formula C19H19NO3Se and a molecular weight of 388.33 g/mol. Its IUPAC name is methyl (E,2S)-2-benzamido-2-methyl-4-phenylselanylbut-3-enoate.
| Compound Name | methyl (E,2S)-2-benzamido-2-methyl-4-phenylselanylbut-3-enoate |
|---|---|
| PubChem CID | 11417836 |
| Molecular Formula | C19H19NO3Se |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl (E,2S)-2-benzamido-2-methyl-4-phenylselanylbut-3-enoate |
| SMILES | COC(=O)[C@](C)(/C=C/[Se]c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3Se/c1-19(18(22)23-2,13-14-24-16-11-7-4-8-12-16)20-17(21)15-9-5-3-6-10-15/h3-14H,1-2H3,(H,20,21)/b14-13+/t19-/m0/s1 |
| InChIKey | YABYJIYTRUHUPM-KQDNUWKFSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|