C27H25NO3 — CID 101108457
methyl (2S,3E)-2-benzamido-2-benzyl-5-phenylhexa-3,5-dienoate (PubChem CID 101108457) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl (2S,3E)-2-benzamido-2-benzyl-5-phenylhexa-3,5-dienoate.
| Compound Name | methyl (2S,3E)-2-benzamido-2-benzyl-5-phenylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 101108457 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl (2S,3E)-2-benzamido-2-benzyl-5-phenylhexa-3,5-dienoate |
| SMILES | C=C(/C=C/[C@](Cc1ccccc1)(NC(=O)c1ccccc1)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C27H25NO3/c1-21(23-14-8-4-9-15-23)18-19-27(26(30)31-2,20-22-12-6-3-7-13-22)28-25(29)24-16-10-5-11-17-24/h3-19H,1,20H2,2H3,(H,28,29)/b19-18+/t27-/m1/s1 |
| InChIKey | HUACOVYSDHPYGD-SRUCCPAXSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|