C12H13Cl2NO — CID 88654986
N-(4,4-dichloro-2-methylbut-3-en-2-yl)benzamide (PubChem CID 88654986) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is N-(4,4-dichloro-2-methylbut-3-en-2-yl)benzamide.
| Compound Name | N-(4,4-dichloro-2-methylbut-3-en-2-yl)benzamide |
|---|---|
| PubChem CID | 88654986 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-(4,4-dichloro-2-methylbut-3-en-2-yl)benzamide |
| SMILES | CC(C)(C=C(Cl)Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13Cl2NO/c1-12(2,8-10(13)14)15-11(16)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,15,16) |
| InChIKey | OWHKSMBZAVJZHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |