C9H7Cl2NO — CID 2131512
N-(2,2-dichloroethenyl)benzamide (PubChem CID 2131512) has the molecular formula C9H7Cl2NO and a molecular weight of 216.07 g/mol. Its IUPAC name is N-(2,2-dichloroethenyl)benzamide.
| Compound Name | N-(2,2-dichloroethenyl)benzamide |
|---|---|
| PubChem CID | 2131512 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | N-(2,2-dichloroethenyl)benzamide |
| SMILES | O=C(NC=C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C9H7Cl2NO/c10-8(11)6-12-9(13)7-4-2-1-3-5-7/h1-6H,(H,12,13) |
| InChIKey | KPHFIGBUDFKPJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |