C9H9Cl2NO4P+ — CID 174677008
N-(2,2-dichloroethenyl)benzamide;dihydroxy(oxo)phosphanium (PubChem CID 174677008) has the molecular formula C9H9Cl2NO4P+ and a molecular weight of 297.05 g/mol. Its IUPAC name is N-(2,2-dichloroethenyl)benzamide;dihydroxy(oxo)phosphanium.
| Compound Name | N-(2,2-dichloroethenyl)benzamide;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 174677008 |
| Molecular Formula | C9H9Cl2NO4P+ |
| Molecular Weight | 297.05 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | N-(2,2-dichloroethenyl)benzamide;dihydroxy(oxo)phosphanium |
| SMILES | O=C(NC=C(Cl)Cl)c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C9H7Cl2NO.HO3P/c10-8(11)6-12-9(13)7-4-2-1-3-5-7;1-4(2)3/h1-6H,(H,12,13);(H-,1,2,3)/p+1 |
| InChIKey | ZAJZUDUNIXSIFF-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.05 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|