C15H19NO — CID 101347654
N-[(1Z,3E)-2-ethylhexa-1,3-dienyl]benzamide (PubChem CID 101347654) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[(1Z,3E)-2-ethylhexa-1,3-dienyl]benzamide.
| Compound Name | N-[(1Z,3E)-2-ethylhexa-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 101347654 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[(1Z,3E)-2-ethylhexa-1,3-dienyl]benzamide |
| SMILES | CC/C=C/C(=C\NC(=O)c1ccccc1)CC |
| InChI | InChI=1S/C15H19NO/c1-3-5-9-13(4-2)12-16-15(17)14-10-7-6-8-11-14/h5-12H,3-4H2,1-2H3,(H,16,17)/b9-5+,13-12- |
| InChIKey | IBBYAFIPUGGOIA-XQJIRVGYSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|