C10H9Cl2NO — CID 651612
N-(2,2-dichloroethenyl)-4-methylbenzamide (PubChem CID 651612) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is N-(2,2-dichloroethenyl)-4-methylbenzamide.
| Compound Name | N-(2,2-dichloroethenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 651612 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | N-(2,2-dichloroethenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC=C(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H9Cl2NO/c1-7-2-4-8(5-3-7)10(14)13-6-9(11)12/h2-6H,1H3,(H,13,14) |
| InChIKey | HPFANBPWWVMZQZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |