C28H25NO3P+ — CID 24827846
(1-benzamido-1-carboxyethyl)-triphenylphosphanium (PubChem CID 24827846) has the molecular formula C28H25NO3P+ and a molecular weight of 454.49 g/mol. Its IUPAC name is (1-benzamido-1-carboxyethyl)-triphenylphosphanium.
| Compound Name | (1-benzamido-1-carboxyethyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 24827846 |
| Molecular Formula | C28H25NO3P+ |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (1-benzamido-1-carboxyethyl)-triphenylphosphanium |
| SMILES | CC(NC(=O)c1ccccc1)(C(=O)O)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24NO3P/c1-28(27(31)32,29-26(30)22-14-6-2-7-15-22)33(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25/h2-21H,1H3,(H-,29,30,31,32)/p+1 |
| InChIKey | BCKRZWSSWFFMAE-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|