C15H20N2O3 — CID 102456070
methyl (2R,3S)-2-(2-benzoylhydrazinyl)-2,3-dimethylpent-4-enoate (PubChem CID 102456070) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl (2R,3S)-2-(2-benzoylhydrazinyl)-2,3-dimethylpent-4-enoate.
| Compound Name | methyl (2R,3S)-2-(2-benzoylhydrazinyl)-2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 102456070 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl (2R,3S)-2-(2-benzoylhydrazinyl)-2,3-dimethylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@](C)(NNC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H20N2O3/c1-5-11(2)15(3,14(19)20-4)17-16-13(18)12-9-7-6-8-10-12/h5-11,17H,1H2,2-4H3,(H,16,18)/t11-,15+/m0/s1 |
| InChIKey | LSNGTVQLPMLZLY-XHDPSFHLSA-N |
| XLogP | 1.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|