C20H23ClN2O — CID 101191317
N'-[(3R,4R)-3-(4-chlorophenyl)-4-methylhex-5-en-3-yl]benzohydrazide (PubChem CID 101191317) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is N'-[(3R,4R)-3-(4-chlorophenyl)-4-methylhex-5-en-3-yl]benzohydrazide.
| Compound Name | N'-[(3R,4R)-3-(4-chlorophenyl)-4-methylhex-5-en-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 101191317 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N'-[(3R,4R)-3-(4-chlorophenyl)-4-methylhex-5-en-3-yl]benzohydrazide |
| SMILES | C=C[C@@H](C)[C@@](CC)(NNC(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-4-15(3)20(5-2,17-11-13-18(21)14-12-17)23-22-19(24)16-9-7-6-8-10-16/h4,6-15,23H,1,5H2,2-3H3,(H,22,24)/t15-,20-/m1/s1 |
| InChIKey | JJAUQLILUDYUOM-FOIQADDNSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|