C16H24N2O — CID 15422396
N'-[(3S,4R)-3,6-dimethylhept-1-en-4-yl]benzohydrazide (PubChem CID 15422396) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N'-[(3S,4R)-3,6-dimethylhept-1-en-4-yl]benzohydrazide.
| Compound Name | N'-[(3S,4R)-3,6-dimethylhept-1-en-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 15422396 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N'-[(3S,4R)-3,6-dimethylhept-1-en-4-yl]benzohydrazide |
| SMILES | C=C[C@H](C)[C@@H](CC(C)C)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-5-13(4)15(11-12(2)3)17-18-16(19)14-9-7-6-8-10-14/h5-10,12-13,15,17H,1,11H2,2-4H3,(H,18,19)/t13-,15+/m0/s1 |
| InChIKey | HGZNHMNCWAUFMW-DZGCQCFKSA-N |
| XLogP | 3.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|