C10H14N2O — CID 172741610
N'-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzohydrazide (PubChem CID 172741610) has the molecular formula C10H14N2O and a molecular weight of 185.28 g/mol. Its IUPAC name is N'-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzohydrazide.
| Compound Name | N'-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 172741610 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 185.28 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N'-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzohydrazide |
| SMILES | [2H]C([2H])([2H])C([2H])(NNC(=O)c1ccccc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H14N2O/c1-8(2)11-12-10(13)9-6-4-3-5-7-9/h3-8,11H,1-2H3,(H,12,13)/i1D3,2D3,8D |
| InChIKey | JEDFDJQCNTWWDS-UNAVHCQLSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|