C16H15F3N2O — CID 146167409
N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]benzohydrazide (PubChem CID 146167409) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]benzohydrazide.
| Compound Name | N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 146167409 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N'-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]benzohydrazide |
| SMILES | C[C@H](NNC(=O)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N2O/c1-11(12-7-9-14(10-8-12)16(17,18)19)20-21-15(22)13-5-3-2-4-6-13/h2-11,20H,1H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | DXNOJBYJCFRWOX-NSHDSACASA-N |
| XLogP | 3.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|