C23H20F2N2O2 — CID 135004139
N'-[(1S)-2,2-difluoro-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]benzohydrazide (PubChem CID 135004139) has the molecular formula C23H20F2N2O2 and a molecular weight of 394.42 g/mol. Its IUPAC name is N'-[(1S)-2,2-difluoro-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]benzohydrazide.
| Compound Name | N'-[(1S)-2,2-difluoro-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]benzohydrazide |
|---|---|
| PubChem CID | 135004139 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-[(1S)-2,2-difluoro-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]benzohydrazide |
| SMILES | Cc1ccc([C@H](NNC(=O)c2ccccc2)C(F)(F)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20F2N2O2/c1-16-12-14-17(15-13-16)20(26-27-22(29)19-10-6-3-7-11-19)23(24,25)21(28)18-8-4-2-5-9-18/h2-15,20,26H,1H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | GZNWTYVGIJCZNS-FQEVSTJZSA-N |
| XLogP | 4.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|