C24H31F2NO3S — CID 129064452
N-[1-(4-butoxyphenyl)-2,2-difluoro-3-(4-methylphenyl)-3-oxopropyl]-2-methylpropane-2-sulfinamide (PubChem CID 129064452) has the molecular formula C24H31F2NO3S and a molecular weight of 451.58 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)-2,2-difluoro-3-(4-methylphenyl)-3-oxopropyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(4-butoxyphenyl)-2,2-difluoro-3-(4-methylphenyl)-3-oxopropyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 129064452 |
| Molecular Formula | C24H31F2NO3S |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[1-(4-butoxyphenyl)-2,2-difluoro-3-(4-methylphenyl)-3-oxopropyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCCCOc1ccc(C(NS(=O)C(C)(C)C)C(F)(F)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H31F2NO3S/c1-6-7-16-30-20-14-12-18(13-15-20)21(27-31(29)23(3,4)5)24(25,26)22(28)19-10-8-17(2)9-11-19/h8-15,21,27H,6-7,16H2,1-5H3 |
| InChIKey | FQCYEIMALGCUCI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|