C17H27NO3S — CID 102289128
ethyl (4R)-4-(tert-butylsulfinylamino)-4-(4-methylphenyl)butanoate (PubChem CID 102289128) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is ethyl (4R)-4-(tert-butylsulfinylamino)-4-(4-methylphenyl)butanoate.
| Compound Name | ethyl (4R)-4-(tert-butylsulfinylamino)-4-(4-methylphenyl)butanoate |
|---|---|
| PubChem CID | 102289128 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | ethyl (4R)-4-(tert-butylsulfinylamino)-4-(4-methylphenyl)butanoate |
| SMILES | CCOC(=O)CC[C@@H](NS(=O)C(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H27NO3S/c1-6-21-16(19)12-11-15(18-22(20)17(3,4)5)14-9-7-13(2)8-10-14/h7-10,15,18H,6,11-12H2,1-5H3/t15-,22?/m1/s1 |
| InChIKey | NNKOZBAVAPNSTA-JGHKVMFLSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |