C14H21BrN2O3S — CID 146182897
ethyl (3S)-3-(2-bromo-4-pyridinyl)-3-(tert-butylsulfinylamino)propanoate (PubChem CID 146182897) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is ethyl (3S)-3-(2-bromo-4-pyridinyl)-3-(tert-butylsulfinylamino)propanoate.
| Compound Name | ethyl (3S)-3-(2-bromo-4-pyridinyl)-3-(tert-butylsulfinylamino)propanoate |
|---|---|
| PubChem CID | 146182897 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | ethyl (3S)-3-(2-bromo-4-pyridinyl)-3-(tert-butylsulfinylamino)propanoate |
| SMILES | CCOC(=O)C[C@H](NS(=O)C(C)(C)C)c1ccnc(Br)c1 |
| InChI | InChI=1S/C14H21BrN2O3S/c1-5-20-13(18)9-11(17-21(19)14(2,3)4)10-6-7-16-12(15)8-10/h6-8,11,17H,5,9H2,1-4H3/t11-,21?/m0/s1 |
| InChIKey | VVUIYPKZEFMRNE-QHIQZGGMSA-N |
| XLogP | 2.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|