C16H24FNO4S — CID 154643173
ethyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-fluoro-4-methoxyphenyl)propanoate (PubChem CID 154643173) has the molecular formula C16H24FNO4S and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-fluoro-4-methoxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-fluoro-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 154643173 |
| Molecular Formula | C16H24FNO4S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl (3S)-3-[[(R)-tert-butylsulfinyl]amino]-3-(3-fluoro-4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](N[S@](=O)C(C)(C)C)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H24FNO4S/c1-6-22-15(19)10-13(18-23(20)16(2,3)4)11-7-8-14(21-5)12(17)9-11/h7-9,13,18H,6,10H2,1-5H3/t13-,23+/m0/s1 |
| InChIKey | XVUPAODJECDBBZ-ZAMGYDSWSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |