C15H19F4NO3S — CID 169493814
methyl 3-(tert-butylsulfinylamino)-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate (PubChem CID 169493814) has the molecular formula C15H19F4NO3S and a molecular weight of 369.38 g/mol. Its IUPAC name is methyl 3-(tert-butylsulfinylamino)-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-(tert-butylsulfinylamino)-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 169493814 |
| Molecular Formula | C15H19F4NO3S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | methyl 3-(tert-butylsulfinylamino)-3-[4-fluoro-3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CC(NS(=O)C(C)(C)C)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F4NO3S/c1-14(2,3)24(22)20-12(8-13(21)23-4)9-5-6-11(16)10(7-9)15(17,18)19/h5-7,12,20H,8H2,1-4H3 |
| InChIKey | ATFUDZMSQNSSRI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |