C14H19ClFNOS — CID 139093252
(S)-N-[(1R)-1-(4-chlorophenyl)-3-fluorobut-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 139093252) has the molecular formula C14H19ClFNOS and a molecular weight of 303.83 g/mol. Its IUPAC name is (S)-N-[(1R)-1-(4-chlorophenyl)-3-fluorobut-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-(4-chlorophenyl)-3-fluorobut-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139093252 |
| Molecular Formula | C14H19ClFNOS |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (S)-N-[(1R)-1-(4-chlorophenyl)-3-fluorobut-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C(F)C[C@@H](N[S@@](=O)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClFNOS/c1-10(16)9-13(17-19(18)14(2,3)4)11-5-7-12(15)8-6-11/h5-8,13,17H,1,9H2,2-4H3/t13-,19+/m1/s1 |
| InChIKey | QRMMTUCWFOJPII-YJYMSZOUSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |