C14H20FNOS — CID 101416892
N-[(1R)-1-(4-fluorophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 101416892) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 101416892 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@H](NS(=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNOS/c1-5-6-13(16-18(17)14(2,3)4)11-7-9-12(15)10-8-11/h5,7-10,13,16H,1,6H2,2-4H3/t13-,18?/m1/s1 |
| InChIKey | AWCRFUKGFNOILX-YJJYDOSJSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|