C13H18ClFN2OS — CID 90199777
N-[(1S)-1-(4-chloro-3-fluoro-2-pyridinyl)but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 90199777) has the molecular formula C13H18ClFN2OS and a molecular weight of 304.82 g/mol. Its IUPAC name is N-[(1S)-1-(4-chloro-3-fluoro-2-pyridinyl)but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-(4-chloro-3-fluoro-2-pyridinyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90199777 |
| Molecular Formula | C13H18ClFN2OS |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[(1S)-1-(4-chloro-3-fluoro-2-pyridinyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](NS(=O)C(C)(C)C)c1nccc(Cl)c1F |
| InChI | InChI=1S/C13H18ClFN2OS/c1-5-6-10(17-19(18)13(2,3)4)12-11(15)9(14)7-8-16-12/h5,7-8,10,17H,1,6H2,2-4H3/t10-,19?/m0/s1 |
| InChIKey | MUQPSKFTWDHCHM-IHBJSSOOSA-N |
| XLogP | 3.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|