C17H21BrN2OS — CID 142402493
(S)-N-[(1S)-1-(4-bromoquinolin-2-yl)but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 142402493) has the molecular formula C17H21BrN2OS and a molecular weight of 381.34 g/mol. Its IUPAC name is (S)-N-[(1S)-1-(4-bromoquinolin-2-yl)but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-(4-bromoquinolin-2-yl)but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 142402493 |
| Molecular Formula | C17H21BrN2OS |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (S)-N-[(1S)-1-(4-bromoquinolin-2-yl)but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](N[S@@](=O)C(C)(C)C)c1cc(Br)c2ccccc2n1 |
| InChI | InChI=1S/C17H21BrN2OS/c1-5-8-15(20-22(21)17(2,3)4)16-11-13(18)12-9-6-7-10-14(12)19-16/h5-7,9-11,15,20H,1,8H2,2-4H3/t15-,22-/m0/s1 |
| InChIKey | ICTIOWHSKQBNRE-NYHFZMIOSA-N |
| XLogP | 4.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|