C17H31Br2N3O2SSi — CID 67355348
N-[(1S)-1-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 67355348) has the molecular formula C17H31Br2N3O2SSi and a molecular weight of 529.42 g/mol. Its IUPAC name is N-[(1S)-1-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67355348 |
| Molecular Formula | C17H31Br2N3O2SSi |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | N-[(1S)-1-[4,5-dibromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@H](NS(=O)C(C)(C)C)c1nc(Br)c(Br)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H31Br2N3O2SSi/c1-8-9-13(21-25(23)17(2,3)4)16-20-14(18)15(19)22(16)12-24-10-11-26(5,6)7/h8,13,21H,1,9-12H2,2-7H3/t13-,25?/m0/s1 |
| InChIKey | GWVIUKRNKKJPDB-GLLGCSJKSA-N |
| XLogP | 5.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|